From Surf Wiki (app.surf) — the open knowledge base
Benzylfentanyl
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| N-(1-Benzylpiperidin-4-yl)-N-phenylpropanamide | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}1474-02-8 Y |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 220920 |
| ECHA InfoCard | 100.014.559 |
| EC Number | 216-014-7 |
| PubChem CID | 252141 |
| UNII | 9BV2D1A57H Y |
| CompTox Dashboard (EPA) | DTXSID00163705 |
| InChI | |
| InChI=1S/C21H26N2O/c1-2-21(24)23(19-11-7-4-8-12-19)20-13-15-22(16-14-20)17-18-9-5-3-6-10-18/h3-12,20H,2,13-17H2,1H3Key: POQDXIFVWVZVML-UHFFFAOYSA-N | |
| SMILES | |
| CCC(=O)N(C1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3 | |
| Chemical formula | C21H26N2O |
| Molar mass | 322.452 g·mol−1 |
| Density | 1.113 g/cm3 |
| Boiling point | 502.2 °C (936.0 °F; 775.3 K) |
| Vapor pressure | 3.36×10−8 mmHg |
| Legal status | DE: Anlage I (Authorized scientific use only) |
| US: List I (a precursor) | |
| GHS labelling: | |
| Pictograms | |
| Signal word | Danger |
| Hazard statements | H301, H412 |
| Precautionary statements | P264, P270, P273, P301+P316, P321, P330, P405, P501 |
| NFPA 704 (fire diamond) | .mw-parser-output .nfpa-704-diamond-ref{float:right;padding:1px;text-align:right}.mw-parser-output .nfpa-704-diamond-container{width:82px;font-family:sans-serif;margin:0 auto}.mw-parser-output .nfpa-704-diamond-container-ref{float:left;margin-left:1em}.mw-parser-output .nfpa-704-diamond-images{float:left;font-size:20px;text-align:center;position:relative;height:80px;width:80px;padding:1px}.mw-parser-output .nfpa-704-diamond-map{position:absolute;height:80px;width:80px}.mw-parser-output .nfpa-704-diamond .noresize{margin:0 auto}.mw-parser-output .nfpa-704-diamond-code{line-height:1em;text-align:center;position:absolute}.mw-parser-output .nfpa-704-diamond-code>a{color:black}.mw-parser-output .nfpa-704-diamond-blue{width:13px;top:31px;left:15px}.mw-parser-output .nfpa-704-diamond-red{width:12px;top:12px;left:35px}.mw-parser-output .nfpa-704-diamond-yellow{width:13px;top:31px;left:54px}.mw-parser-output .nfpa-704-diamond-white-image{position:relative;top:51px;left:0}.mw-parser-output .nfpa-704-diamond-white-text{vertical-align:middle;text-align:center;line-height:80%;position:absolute;top:52px}.mw-parser-output .nfpa-704-diamond-white-text a>span{position:absolute;color:black}.mw-parser-output .nfpa-704-diamond-white-wors{font-size:15px;width:23px;left:29px}.mw-parser-output .nfpa-704-diamond-white-wox{font-size:15px;font-stretch:condensed;width:21px;line-height:80%;top:-4px;left:29px}.mw-parser-output .nfpa-704-diamond-white-abcp{font-size:13.5px;font-stretch:condensed;width:28px;left:26px}.mw-parser-output .nfpa-704-diamond-white-ac{font-size:10px;width:30px;left:25px}.mw-parser-output .nfpa-704-diamond-white-strike{text-decoration:line-through} |
3 0 0 | | Flash point | 257.5 °C (495.5 °F; 530.6 K) | | Lethal dose or concentration (LD, LC): | | | LD50 (median dose) | 500 mg/kg (oral, as HCl salt, est.) | | Safety data sheet (SDS) | CATO Research Chemicals | | Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references | |
Benzylfentanyl (R-4129) is a fentanyl analog. It was temporarily placed in the US Schedule I by emergency scheduling in 1985 due to concerns about its potential for abuse as a designer drug, but this placement was allowed to expire and benzylfentanyl was formally removed from controlled substance listing in 2010, after the DEA's testing determined it to be "essentially inactive" as an opioid. It was added as a List I precursor instead in 2020 after it was determined that it was being used in fentanyl manufacture, which was previously thought to be beyond the technical capability of illicit labs. Benzylfentanyl has a Ki of 213 nM at the mu opioid receptor, binding around .mw-parser-output .sfrac{white-space:nowrap}.mw-parser-output .sfrac.tion,.mw-parser-output .sfrac .tion{display:inline-block;vertical-align:-0.5em;font-size:85%;text-align:center;margin-left:.1em;margin-right:.1em}.mw-parser-output .sfrac .num{display:block;border-bottom:1px solid}.mw-parser-output .sfrac .den{display:block;line-height:1.5em}.mw-parser-output .sr-only{border:0;clip:rect(0,0,0,0);clip-path:polygon(0px 0px,0px 0px,0px 0px);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}1/200 as strong as fentanyl itself, though it is still slightly more potent than codeine.
- Homofentanyl
- Isofentanyl
Ask Mako anything about Benzylfentanyl — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report