From Surf Wiki (app.surf) — the open knowledge base
Benzo(e)pyrene
Benzo[e]pyrene is a polycyclic aromatic hydrocarbon with the chemical formula C20H12. It is listed as a Group 3 carcinogen by the IARC.
| Column 1 | Column 2 |
|---|---|
| Benzo[e]pyrene | |
| Preferred IUPAC name | |
| Benzo[e]pyrene | |
| Other names | |
| Pentacyclo[10.6.2.02,7.08,20.015,19]icosa-1,3,5,7,9,11,13,15,17,19-decaene | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}192-97-2 Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:34567 Y |
| ChEMBL | ChEMBL1371125 N |
| ChemSpider | 8774 Y |
| ECHA InfoCard | 100.005.358 |
| EC Number | 205-892-7 |
| KEGG | C14435 Y |
| PubChem CID | 9128 |
| RTECS number | DJ4200000 |
| UNII | 63APT6398R |
| UN number | 3077 |
| CompTox Dashboard (EPA) | DTXSID3023764 |
| InChI | |
| InChI=1S/C20H12/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12H YKey: TXVHTIQJNYSSKO-UHFFFAOYSA-N YInChI=1/C20H12/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12HKey: TXVHTIQJNYSSKO-UHFFFAOYAC | |
| SMILES | |
| c3ccc2ccc1cccc4c1c2c3c5c4cccc5 | |
| Chemical formula | C20H12 |
| Molar mass | 252.316 g·mol−1 |
| Density | 1.286 g/cm3 |
| GHS labelling: | |
| Pictograms | |
| Signal word | Danger |
| Hazard statements | H350, H410 |
| Precautionary statements | P201, P202, P273, P281, P308+P313, P391, P405, P501 |
| Flash point | 228.6 °C (443.5 °F; 501.8 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| N verify (what is YN ?) |
Infobox references | |
Benzo[e]pyrene is a polycyclic aromatic hydrocarbon with the chemical formula C20H12. It is listed as a Group 3 carcinogen by the IARC.
- Benzopyrene
- Benzo[a]pyrene
- Benzene
- Pyrene, a four-ring analogue
Ask Mako anything about Benzo(e)pyrene — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report