From Surf Wiki (app.surf) — the open knowledge base
4-Butylresorcinol
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| 4-Butylbenzene-1,3-diol | |
| Other names | |
| Rucinol, 4-n-Butylresorcinol | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}18979-61-8 |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:81689 |
| ChEMBL | ChEMBL450195 |
| ChemSpider | 178414 |
| ECHA InfoCard | 100.126.948 |
| EC Number | 606-191-2 |
| KEGG | C18343 |
| PubChem CID | 205912 |
| UNII | 2IK4UQ3ZGA |
| CompTox Dashboard (EPA) | DTXSID50172403 |
| InChI | |
| InChI=1S/C10H14O2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h5-7,11-12H,2-4H2,1H3Key: CSHZYWUPJWVTMQ-UHFFFAOYSA-N | |
| SMILES | |
| CCCCC1=C(C=C(C=C1)O)O | |
| Chemical formula | C10H14O2 |
| Molar mass | 166.220 g·mol−1 |
| GHS labelling: | |
| Pictograms | |
| Signal word | Warning |
| Hazard statements | H302, H315, H319, H400 |
| Precautionary statements | P264, P270, P273, P280, P301+P312, P302+P352, P305+P351+P338, P321, P330, P332+P313, P337+P313, P362, P391, P501 |
| Lethal dose or concentration (LD, LC): | |
| LD50 (median dose) | 500mg/kg (rat) |
| Safety data sheet (SDS) | |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references | |
4-Butylresorcinol, sometimes called 4-n-butylresorcinol, is a chemical used to treat hyperpigmentation of the epidermis. Hyperpigmentation is believed to be related to the enzyme tyrosinase which produces melanin. Among several chemicals known to inhibit tyrosinase production, such as hydroquinone, arbutin, and kojic acid, 4-butylresorcinol has been found to be the most powerful inhibitor by IC50, but the mode of inhibition is reversible. 4-Butylresorcinol can be used in the synthesis of tetrahydrocannabutol.
| compound | in vitro IC50 | in vivo |
|---|---|---|
| arbutin | > 5000 | |
| hydroquinone | > 1000 | < 40 |
| kojic acid | 500 | |
| 4-n-butylresorcinol | 21 | 13.5 |
Ask Mako anything about 4-Butylresorcinol — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report