From Surf Wiki (app.surf) — the open knowledge base
3,5-Dihydroxybenzoic acid
3,5-Dihydroxybenzoic acid (α-resorcylic acid) is a dihydroxybenzoic acid. It is a colorless solid.
| Column 1 | Column 2 |
|---|---|
| Chemical structure of 3,5-dihydroxybenzoic acid | |
| Preferred IUPAC name | |
| 3,5-Dihydroxybenzoic acid | |
| Other names | |
| α-Resorcylic acid | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}99-10-5 Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:39912 |
| ChEMBL | ChEMBL95308 Y |
| ChemSpider | 7146 Y |
| ECHA InfoCard | 100.002.482 |
| EC Number | 202-730-7 |
| IUPHAR/BPS | 5783 |
| PubChem CID | 7424 |
| UNII | 2WC5LMO6L1 Y |
| CompTox Dashboard (EPA) | DTXSID8059184 |
| InChI | |
| InChI=1S/C7H6O4/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,8-9H,(H,10,11) YKey: UYEMGAFJOZZIFP-UHFFFAOYSA-N Y | |
| SMILES | |
| C1=C(C=C(C=C1O)O)C(=O)O | |
| Chemical formula | C7H6O4 |
| Molar mass | 154.121 g·mol−1 |
| Melting point | 235.3 °C (455.5 °F; 508.4 K) |
| Solubility in water | soluble |
| Solubility in acetone | soluble |
| Solubility in ethanol | very soluble |
| Solubility in diethyl ether | very soluble |
| Acidity (pKa) | 4.04 |
| GHS labelling: | |
| Pictograms | |
| Signal word | Warning |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
| Related compounds | 2,3-Dihydroxybenzoic acid2,4-Dihydroxybenzoic acid2,5-Dihydroxybenzoic acid2,6-Dihydroxybenzoic acid3,4-Dihydroxybenzoic acid |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| Y verify (what is YN ?) |
Infobox references | |
3,5-Dihydroxybenzoic acid (α-resorcylic acid) is a dihydroxybenzoic acid. It is a colorless solid.
It is prepared by disulfonation of benzoic acid followed by hydrolysis of the disulfonate.
It is a metabolite of alkylresorcinols, first identified in human urine and can be quantified in urine and plasma, and may be an alternative, equivalent biomarker of whole grain wheat intake.
Ask Mako anything about 3,5-Dihydroxybenzoic acid — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report