From Surf Wiki (app.surf) — the open knowledge base
2-Nitrofluorene
2-Nitrofluorene is a by-product of combustion and is a nitrated polycyclic aromatic hydrocarbon (fluorene). 2-Nitrofluorene is listed as an IARC Group 2B carcinogen, indicating it is possibly carcinogenic to humans.
| Column 1 | Column 2 |
|---|---|
| Kekulé, skeletal formula of 2-nitrofluorene | |
| Preferred IUPAC name | |
| 2-Nitro-9H-fluorene | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}607-57-8 N |
| 3D model (JSmol) | Interactive imageInteractive image |
| Beilstein Reference | 1877983 |
| ChEBI | CHEBI:1224 Y |
| ChEMBL | ChEMBL351487 Y |
| ChemSpider | 11338 Y |
| ECHA InfoCard | 100.009.217 |
| EC Number | 210-138-5 |
| KEGG | C10923 N |
| MeSH | 2-Nitrofluorene |
| PubChem CID | 11831 |
| RTECS number | LL8225000 |
| UNII | 191LL4U4GZ Y |
| UN number | 3077 |
| CompTox Dashboard (EPA) | DTXSID2020971 |
| InChI | |
| InChI=1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 YKey: XFOHWECQTFIEIX-UHFFFAOYSA-N Y | |
| SMILES | |
| [O-]N+c1ccc2c(Cc3ccccc-23)c1[O-]N+C1=CC2=C(C=C1)C1=CC=CC=C1C2 | |
| Chemical formula | C13H9NO2 |
| Molar mass | 211.220 g·mol−1 |
| Melting point | 156 to 158 °C (313 to 316 °F; 429 to 431 K) |
| log P | 3.982 |
| GHS labelling: | |
| Pictograms | |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P281 |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| N verify (what is YN ?) |
Infobox references | |
2-Nitrofluorene is a by-product of combustion and is a nitrated polycyclic aromatic hydrocarbon (fluorene). 2-Nitrofluorene is listed as an IARC Group 2B carcinogen, indicating it is possibly carcinogenic to humans.
Ask Mako anything about 2-Nitrofluorene — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report