From Surf Wiki (app.surf) — the open knowledge base
2-Methylheptane
2-Methylheptane is a branched-chain alkane and an isomer of octane. It is an heptane molecule with a methyl group attached to its second atom. It is a flammable colorless liquid used as fuel.
| Column 1 | Column 2 |
|---|---|
| Skeletal formula of 2-methylheptane | |
| Spacefill model of 2-methylheptane | |
| Preferred IUPAC name | |
| 2-Methylheptane | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}592-27-8 Y |
| 3D model (JSmol) | Interactive image |
| Beilstein Reference | 1696862 |
| ChEBI | CHEBI:88849 N |
| ChemSpider | 11106 Y |
| ECHA InfoCard | 100.008.863 |
| EC Number | 209-747-9 |
| PubChem CID | 11594 |
| UNII | YU6SU8CCVB Y |
| UN number | 1262 |
| CompTox Dashboard (EPA) | DTXSID2060460 |
| InChI | |
| InChI=1S/C8H18/c1-4-5-6-7-8(2)3/h8H,4-7H2,1-3H3 YKey: JVSWJIKNEAIKJW-UHFFFAOYSA-N Y | |
| SMILES | |
| CCCCCC(C)C | |
| Chemical formula | C8H18 |
| Molar mass | 114.232 g·mol−1 |
| Appearance | Colourless liquid |
| Odor | Odourless |
| Density | 698 mg mL−1 |
| Melting point | −112 to −108 °C; −170 to −163 °F; 161 to 165 K |
| Boiling point | 116.8 to 118.4 °C; 242.2 to 245.0 °F; 389.9 to 391.5 K |
| Vapor pressure | 5.3 kPa (at 37.7 °C) |
| Henry's lawconstant (kH) | 2.7 nmol Pa−1 kg−1 |
| Refractive index (nD) | 1.395–1.396 |
| Heat capacity (C) | 252.00 J K−1 mol−1 |
| Std molarentropy (S⦵298) | 356.39 J K−1 mol−1 |
| Std enthalpy offormation (ΔfH⦵298) | −256.5–−253.9 kJ mol−1 |
| Std enthalpy ofcombustion (ΔcH⦵298) | −5466.7–−5464.3 kJ mol−1 |
| GHS labelling: | |
| Pictograms | |
| Signal word | Danger |
| Hazard statements | H225, H304, H315, H336, H410 |
| Precautionary statements | P210, P261, P273, P301+P310, P331 |
| NFPA 704 (fire diamond) | .mw-parser-output .nfpa-704-diamond-ref{float:right;padding:1px;text-align:right}.mw-parser-output .nfpa-704-diamond-container{width:82px;font-family:sans-serif;margin:0 auto}.mw-parser-output .nfpa-704-diamond-container-ref{float:left;margin-left:1em}.mw-parser-output .nfpa-704-diamond-images{float:left;font-size:20px;text-align:center;position:relative;height:80px;width:80px;padding:1px}.mw-parser-output .nfpa-704-diamond-map{position:absolute;height:80px;width:80px}.mw-parser-output .nfpa-704-diamond .noresize{margin:0 auto}.mw-parser-output .nfpa-704-diamond-code{line-height:1em;text-align:center;position:absolute}.mw-parser-output .nfpa-704-diamond-code>a{color:black}.mw-parser-output .nfpa-704-diamond-blue{width:13px;top:31px;left:15px}.mw-parser-output .nfpa-704-diamond-red{width:12px;top:12px;left:35px}.mw-parser-output .nfpa-704-diamond-yellow{width:13px;top:31px;left:54px}.mw-parser-output .nfpa-704-diamond-white-image{position:relative;top:51px;left:0}.mw-parser-output .nfpa-704-diamond-white-text{vertical-align:middle;text-align:center;line-height:80%;position:absolute;top:52px}.mw-parser-output .nfpa-704-diamond-white-text a>span{position:absolute;color:black}.mw-parser-output .nfpa-704-diamond-white-wors{font-size:15px;width:23px;left:29px}.mw-parser-output .nfpa-704-diamond-white-wox{font-size:15px;font-stretch:condensed;width:21px;line-height:80%;top:-4px;left:29px}.mw-parser-output .nfpa-704-diamond-white-abcp{font-size:13.5px;font-stretch:condensed;width:28px;left:26px}.mw-parser-output .nfpa-704-diamond-white-ac{font-size:10px;width:30px;left:25px}.mw-parser-output .nfpa-704-diamond-white-strike{text-decoration:line-through} |
0 3 0 | | Flash point | 4.4 °C (39.9 °F; 277.5 K) | | Explosive limits | 0.98–?% | | Related alkanes | 2-Methylhexane3-Methylhexane3-Methylheptane | | Related compounds | Valnoctamide2-EthylhexanolValpromide2-Ethylhexanoic acidPropylheptyl alcohol | | Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?)
Infobox references | |
2-Methylheptane is a branched-chain alkane and an isomer of octane. It is an heptane molecule with a methyl group attached to its second atom. It is a flammable colorless liquid used as fuel.
If the standard definition of the prefix "iso-" is strictly used then 2-methylheptane can be called "Isooctane". However this name is usually used for another much more important isomer of octane 2,2,4-trimethylpentane.
- International Chemical Safety Card 0731
- Chemical and physical properties table
Ask Mako anything about 2-Methylheptane — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report