From Surf Wiki (app.surf) — the open knowledge base
2-Heptanol
2-Heptanol is a chemical compound which is an isomer of heptanol. It is a secondary alcohol with the hydroxyl on the second carbon of the straight seven-carbon chain. The compound is flammable and irritant, and through inhalation, ingestion or though skin it can enter into the body.
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| Heptan-2-ol | |
| Other names | |
| s-Heptyl alcohol | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}543-49-7 Y |
| 3D model (JSmol) | Interactive image |
| ChEBI | CHEBI:88815 |
| ChEMBL | ChEMBL449522 Y |
| ChemSpider | 10511 Y |
| ECHA InfoCard | 100.008.041 |
| PubChem CID | 10976 |
| UNII | E12FIG07JK Y |
| CompTox Dashboard (EPA) | DTXSID1047158 |
| InChI | |
| InChI=1S/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3 YKey: CETWDUZRCINIHU-UHFFFAOYSA-N YInChI=1/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3Key: CETWDUZRCINIHU-UHFFFAOYAL | |
| SMILES | |
| OC(C)CCCCC | |
| Chemical formula | C7H16O |
| Molar mass | 116.204 g·mol−1 |
| Density | 0.817 g/mL |
| Melting point | −30.2 °C (−22.4 °F; 243.0 K) |
| Boiling point | 159 °C (318 °F; 432 K) |
| Solubility in water | 3.3 g/L |
| Solubility | soluble in ethanol, diethyl ether |
| Viscosity | 3.955 mPa·s |
| Flash point | 71 °C (160 °F; 344 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| Y verify (what is YN ?) |
Infobox references | |
2-Heptanol is a chemical compound which is an isomer of heptanol. It is a secondary alcohol with the hydroxyl on the second carbon of the straight seven-carbon chain. The compound is flammable and irritant, and through inhalation, ingestion or though skin it can enter into the body.
2-Heptanol is chiral, so (R)- and (S)-isomers exist.
- 1-Heptanol
- 3-Heptanol
- 4-Heptanol
Ask Mako anything about 2-Heptanol — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report