From Surf Wiki (app.surf) — the open knowledge base
2,2'-Dipyridylamine
2,2′-Dipyridylamine is an organic compound with the formula (C5H4N)2NH. It consists of a pair of 2-pyridyl groups (C5H4N) linked to a secondary amine. The compound forms a range of coordination complexes. Its conjugate base, 2,2′-dipyridylamide, forms extended metal atom chains.
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| N-(Pyridin-2-yl)pyridin-2-amine | |
| Other names | |
| 2,2′-Iminodipyridine | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}1202-34-2 |
| 3D model (JSmol) | Interactive image |
| ChEMBL | ChEMBL1735909 |
| ChemSpider | 13888 |
| ECHA InfoCard | 100.013.513 |
| EC Number | 214-864-3 |
| PubChem CID | 14547 |
| UNII | X9BF664YAK |
| CompTox Dashboard (EPA) | DTXSID5061619 |
| InChI | |
| InChI=1S/C10H9N3/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h1-8H,(H,11,12,13)Key: HMMPCBAWTWYFLR-UHFFFAOYSA-N | |
| SMILES | |
| C1=CC=NC(=C1)NC2=CC=CC=N2 | |
| Chemical formula | C10H9N3 |
| Molar mass | 171.203 g·mol−1 |
| Appearance | white solid |
| Melting point | 90.5 °C (194.9 °F; 363.6 K) |
| Boiling point | 307.5 °C (585.5 °F; 580.6 K) |
| GHS labelling: | |
| Pictograms | |
| Signal word | Warning |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references | |
2,2′-Dipyridylamine is an organic compound with the formula (C5H4N)2NH. It consists of a pair of 2-pyridyl groups (C5H4N) linked to a secondary amine. The compound forms a range of coordination complexes. Its conjugate base, 2,2′-dipyridylamide, forms extended metal atom chains.
2,2′-Dipyridylamine can be formed by heating pyridine with sodium amide. Alternatively, 2-aminopyridine can be heated with 2-chloropyridine over barium oxide.
Ask Mako anything about 2,2'-Dipyridylamine — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report